About (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron
(E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron (PubChem CID 174388548) has the molecular formula C9H7ClN+
and a molecular weight of 164.61 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron.
Molecular Properties
| Compound Name | (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron |
| PubChem CID | 174388548 |
| Molecular Formula | C9H7ClN+ |
| Molecular Weight | 164.61 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron |
| SMILES | N#C/C=C/c1ccccc1Cl.[H+] |
| InChI | InChI=1S/C9H6ClN/c10-9-6-2-1-4-8(9)5-3-7-11/h1-6H/p+1/b5-3+ |
| InChIKey | PWWUUGALKZGDSD-HWKANZROSA-O |
| XLogP | 2.99 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron?
The IUPAC name of (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron (CID 174388548) is (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron.
What is the SMILES notation for (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron?
The canonical SMILES for (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron is N#C/C=C/c1ccccc1Cl.[H+].
What is the InChIKey of (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron?
The InChIKey is PWWUUGALKZGDSD-HWKANZROSA-O. The full InChI is InChI=1S/C9H6ClN/c10-9-6-2-1-4-8(9)5-3-7-11/h1-6H/p+1/b5-3+.
What are the key properties of (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron?
(E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron has a molecular weight of 164.61 g/mol, XLogP of 2.99, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2-chlorophenyl)prop-2-enenitrile;hydron is sourced from PubChem (CID 174388548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).