C13H13ClO2 — CID 91012118
ethyl 5-(2-chlorophenyl)penta-2,4-dienoate (PubChem CID 91012118) has the molecular formula C13H13ClO2 and a molecular weight of 236.70 g/mol. Its IUPAC name is ethyl 5-(2-chlorophenyl)penta-2,4-dienoate.
| Compound Name | ethyl 5-(2-chlorophenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 91012118 |
| Molecular Formula | C13H13ClO2 |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | ethyl 5-(2-chlorophenyl)penta-2,4-dienoate |
| SMILES | CCOC(=O)C=CC=Cc1ccccc1Cl |
| InChI | InChI=1S/C13H13ClO2/c1-2-16-13(15)10-6-4-8-11-7-3-5-9-12(11)14/h3-10H,2H2,1H3 |
| InChIKey | PVDJAVALEAGAAW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|