C19H14ClO2- — CID 18705698
2-[2-[(1E,3E)-4-(2-chlorophenyl)buta-1,3-dienyl]phenyl]prop-2-enoate (PubChem CID 18705698) has the molecular formula C19H14ClO2- and a molecular weight of 309.77 g/mol. Its IUPAC name is 2-[2-[(1E,3E)-4-(2-chlorophenyl)buta-1,3-dienyl]phenyl]prop-2-enoate.
| Compound Name | 2-[2-[(1E,3E)-4-(2-chlorophenyl)buta-1,3-dienyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 18705698 |
| Molecular Formula | C19H14ClO2- |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-[2-[(1E,3E)-4-(2-chlorophenyl)buta-1,3-dienyl]phenyl]prop-2-enoate |
| SMILES | C=C(C(=O)[O-])c1ccccc1/C=C/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C19H15ClO2/c1-14(19(21)22)17-12-6-4-9-15(17)8-2-3-10-16-11-5-7-13-18(16)20/h2-13H,1H2,(H,21,22)/p-1/b8-2+,10-3+ |
| InChIKey | DKIVBCFDNXSTLP-LFQLTVTGSA-M |
| XLogP | 3.83 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|