C11H10O2 — CID 20520746
2-[(1E)-buta-1,3-dienyl]benzoic acid (PubChem CID 20520746) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-[(1E)-buta-1,3-dienyl]benzoic acid.
| Compound Name | 2-[(1E)-buta-1,3-dienyl]benzoic acid |
|---|---|
| PubChem CID | 20520746 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2-[(1E)-buta-1,3-dienyl]benzoic acid |
| SMILES | C=C/C=C/c1ccccc1C(=O)O |
| InChI | InChI=1S/C11H10O2/c1-2-3-6-9-7-4-5-8-10(9)11(12)13/h2-8H,1H2,(H,12,13)/b6-3+ |
| InChIKey | BWBHSPBUFMDJAH-ZZXKWVIFSA-N |
| XLogP | 2.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|