About 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene
2-ethenylbenzoic acid;prop-1-en-2-ylbenzene (PubChem CID 174866821) has the molecular formula C18H18O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene |
| PubChem CID | 174866821 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1ccccc1.C=Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C9H8O2.C9H10/c1-2-7-5-3-4-6-8(7)9(10)11;1-8(2)9-6-4-3-5-7-9/h2-6H,1H2,(H,10,11);3-7H,1H2,2H3 |
| InChIKey | QNZVKJXVCFRLLG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene?
The IUPAC name of 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene (CID 174866821) is 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene.
What is the SMILES notation for 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene?
The canonical SMILES for 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene is C=C(C)c1ccccc1.C=Cc1ccccc1C(=O)O.
What is the InChIKey of 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene?
The InChIKey is QNZVKJXVCFRLLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.C9H10/c1-2-7-5-3-4-6-8(7)9(10)11;1-8(2)9-6-4-3-5-7-9/h2-6H,1H2,(H,10,11);3-7H,1H2,2H3.
What are the key properties of 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene?
2-ethenylbenzoic acid;prop-1-en-2-ylbenzene has a molecular weight of 266.34 g/mol, XLogP of 4.75, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylbenzoic acid;prop-1-en-2-ylbenzene is sourced from PubChem (CID 174866821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).