About 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride
1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride (PubChem CID 172775927) has the molecular formula C16H13ClO2
and a molecular weight of 272.73 g/mol. Its IUPAC name is 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride |
| PubChem CID | 172775927 |
| Molecular Formula | C16H13ClO2 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride |
| SMILES | C=Cc1ccccc1C(=O)C(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C16H12O2.ClH/c1-2-12-8-6-7-11-14(12)16(18)15(17)13-9-4-3-5-10-13;/h2-11H,1H2;1H |
| InChIKey | NOYWYSIYVCOOKK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride?
The IUPAC name of 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride (CID 172775927) is 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride.
What is the SMILES notation for 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride?
The canonical SMILES for 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride is C=Cc1ccccc1C(=O)C(=O)c1ccccc1.Cl.
What is the InChIKey of 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride?
The InChIKey is NOYWYSIYVCOOKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O2.ClH/c1-2-12-8-6-7-11-14(12)16(18)15(17)13-9-4-3-5-10-13;/h2-11H,1H2;1H.
What are the key properties of 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride?
1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride has a molecular weight of 272.73 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethenylphenyl)-2-phenylethane-1,2-dione;hydrochloride is sourced from PubChem (CID 172775927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).