C20H16O4 — CID 21425657
(Z)-2,3-bis(2-ethenylphenyl)but-2-enedioic acid (PubChem CID 21425657) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is (Z)-2,3-bis(2-ethenylphenyl)but-2-enedioic acid.
| Compound Name | (Z)-2,3-bis(2-ethenylphenyl)but-2-enedioic acid |
|---|---|
| PubChem CID | 21425657 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (Z)-2,3-bis(2-ethenylphenyl)but-2-enedioic acid |
| SMILES | C=Cc1ccccc1/C(C(=O)O)=C(/C(=O)O)c1ccccc1C=C |
| InChI | InChI=1S/C20H16O4/c1-3-13-9-5-7-11-15(13)17(19(21)22)18(20(23)24)16-12-8-6-10-14(16)4-2/h3-12H,1-2H2,(H,21,22)(H,23,24)/b18-17- |
| InChIKey | WLFXFFJBHUTVAG-ZCXUNETKSA-N |
| XLogP | 4.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|