C18H16O2 — CID 102031724
1-[2-(2-methylprop-1-enyl)phenyl]-2-phenylethane-1,2-dione (PubChem CID 102031724) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[2-(2-methylprop-1-enyl)phenyl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[2-(2-methylprop-1-enyl)phenyl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 102031724 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-[2-(2-methylprop-1-enyl)phenyl]-2-phenylethane-1,2-dione |
| SMILES | CC(C)=Cc1ccccc1C(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16O2/c1-13(2)12-15-10-6-7-11-16(15)18(20)17(19)14-8-4-3-5-9-14/h3-12H,1-2H3 |
| InChIKey | SVJYBGDPIOKSNM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|