About (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate)
(4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate) (PubChem CID 6433758) has the molecular formula C22H26Cl2N4O4
and a molecular weight of 481.38 g/mol. Its IUPAC name is (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate).
Molecular Properties
| Compound Name | (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate) |
| PubChem CID | 6433758 |
| Molecular Formula | C22H26Cl2N4O4 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate) |
| SMILES | O=C([O-])/C=C/c1ccccc1Cl.O=C([O-])/C=C/c1ccccc1Cl.[NH3+]N1CCN([NH3+])CC1 |
| InChI | InChI=1S/2C9H7ClO2.C4H12N4/c2*10-8-4-2-1-3-7(8)5-6-9(11)12;5-7-1-2-8(6)4-3-7/h2*1-6H,(H,11,12);1-6H2/b2*6-5+; |
| InChIKey | QUPWYAALBFTQFV-PJJNIZFLSA-N |
| XLogP | -0.88 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate)?
The IUPAC name of (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate) (CID 6433758) is (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate).
What is the SMILES notation for (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate)?
The canonical SMILES for (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate) is O=C([O-])/C=C/c1ccccc1Cl.O=C([O-])/C=C/c1ccccc1Cl.[NH3+]N1CCN([NH3+])CC1.
What is the InChIKey of (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate)?
The InChIKey is QUPWYAALBFTQFV-PJJNIZFLSA-N. The full InChI is InChI=1S/2C9H7ClO2.C4H12N4/c2*10-8-4-2-1-3-7(8)5-6-9(11)12;5-7-1-2-8(6)4-3-7/h2*1-6H,(H,11,12);1-6H2/b2*6-5+;.
What are the key properties of (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate)?
(4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate) has a molecular weight of 481.38 g/mol, XLogP of -0.88, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-azaniumylpiperazin-1-yl)azanium;bis((E)-3-(2-chlorophenyl)prop-2-enoate) is sourced from PubChem (CID 6433758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).