C10H6ClF3O — CID 23274147
(Z)-4-(2-chlorophenyl)-1,1,1-trifluorobut-3-en-2-one (PubChem CID 23274147) has the molecular formula C10H6ClF3O and a molecular weight of 234.60 g/mol. Its IUPAC name is (Z)-4-(2-chlorophenyl)-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | (Z)-4-(2-chlorophenyl)-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 23274147 |
| Molecular Formula | C10H6ClF3O |
| Molecular Weight | 234.60 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | (Z)-4-(2-chlorophenyl)-1,1,1-trifluorobut-3-en-2-one |
| SMILES | O=C(/C=C\c1ccccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H6ClF3O/c11-8-4-2-1-3-7(8)5-6-9(15)10(12,13)14/h1-6H/b6-5- |
| InChIKey | IAJCIZLVVTVUKN-WAYWQWQTSA-N |
| XLogP | 3.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.60 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|