C15H9ClF2O — CID 7945580
(E)-3-(2-chlorophenyl)-1-(3,4-difluorophenyl)prop-2-en-1-one (PubChem CID 7945580) has the molecular formula C15H9ClF2O and a molecular weight of 278.69 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-(3,4-difluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-(3,4-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7945580 |
| Molecular Formula | C15H9ClF2O |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-(3,4-difluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1Cl)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H9ClF2O/c16-12-4-2-1-3-10(12)6-8-15(19)11-5-7-13(17)14(18)9-11/h1-9H/b8-6+ |
| InChIKey | OXZJSJIYUFKTBA-SOFGYWHQSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|