C17H12F2O3 — CID 9035738
methyl 2-[(E)-3-(3,4-difluorophenyl)-3-oxoprop-1-enyl]benzoate (PubChem CID 9035738) has the molecular formula C17H12F2O3 and a molecular weight of 302.28 g/mol. Its IUPAC name is methyl 2-[(E)-3-(3,4-difluorophenyl)-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 2-[(E)-3-(3,4-difluorophenyl)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 9035738 |
| Molecular Formula | C17H12F2O3 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | methyl 2-[(E)-3-(3,4-difluorophenyl)-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccccc1/C=C/C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H12F2O3/c1-22-17(21)13-5-3-2-4-11(13)7-9-16(20)12-6-8-14(18)15(19)10-12/h2-10H,1H3/b9-7+ |
| InChIKey | FJHCVQDSUBBTKN-VQHVLOKHSA-N |
| XLogP | 3.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|