C18H11F2NO — CID 71423090
1-(3,4-difluorophenyl)-3-quinolin-4-ylprop-2-en-1-one (PubChem CID 71423090) has the molecular formula C18H11F2NO and a molecular weight of 295.29 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-quinolin-4-ylprop-2-en-1-one.
| Compound Name | 1-(3,4-difluorophenyl)-3-quinolin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 71423090 |
| Molecular Formula | C18H11F2NO |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-quinolin-4-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccnc2ccccc12)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H11F2NO/c19-15-7-5-13(11-16(15)20)18(22)8-6-12-9-10-21-17-4-2-1-3-14(12)17/h1-11H |
| InChIKey | CYAMGPKLFSKWFI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|