C13H15NO3 — CID 145399422
N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid (PubChem CID 145399422) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid.
| Compound Name | N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid |
|---|---|
| PubChem CID | 145399422 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid |
| SMILES | C=Cc1cccc(NC(C)=O)c1C=C.O=CO |
| InChI | InChI=1S/C12H13NO.CH2O2/c1-4-10-7-6-8-12(11(10)5-2)13-9(3)14;2-1-3/h4-8H,1-2H2,3H3,(H,13,14);1H,(H,2,3) |
| InChIKey | NBKIEWPDFYNWEM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|