About N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid
N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid (PubChem CID 145399422) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid.
Molecular Properties
| Compound Name | N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid |
| PubChem CID | 145399422 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid |
| SMILES | C=Cc1cccc(NC(C)=O)c1C=C.O=CO |
| InChI | InChI=1S/C12H13NO.CH2O2/c1-4-10-7-6-8-12(11(10)5-2)13-9(3)14;2-1-3/h4-8H,1-2H2,3H3,(H,13,14);1H,(H,2,3) |
| InChIKey | NBKIEWPDFYNWEM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid?
The IUPAC name of N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid (CID 145399422) is N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid.
What is the SMILES notation for N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid?
The canonical SMILES for N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid is C=Cc1cccc(NC(C)=O)c1C=C.O=CO.
What is the InChIKey of N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid?
The InChIKey is NBKIEWPDFYNWEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO.CH2O2/c1-4-10-7-6-8-12(11(10)5-2)13-9(3)14;2-1-3/h4-8H,1-2H2,3H3,(H,13,14);1H,(H,2,3).
What are the key properties of N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid?
N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid has a molecular weight of 233.27 g/mol, XLogP of 2.63, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,3-bis(ethenyl)phenyl]acetamide;formic acid is sourced from PubChem (CID 145399422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).