About 4-ethenyl-2,3-diethylaniline
4-ethenyl-2,3-diethylaniline (PubChem CID 70188085) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 4-ethenyl-2,3-diethylaniline.
Molecular Properties
| Compound Name | 4-ethenyl-2,3-diethylaniline |
| PubChem CID | 70188085 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-ethenyl-2,3-diethylaniline |
| SMILES | C=Cc1ccc(N)c(CC)c1CC |
| InChI | InChI=1S/C12H17N/c1-4-9-7-8-12(13)11(6-3)10(9)5-2/h4,7-8H,1,5-6,13H2,2-3H3 |
| InChIKey | DNDLJWLYYHKICX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-2,3-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2,3-diethylaniline?
The IUPAC name of 4-ethenyl-2,3-diethylaniline (CID 70188085) is 4-ethenyl-2,3-diethylaniline.
What is the SMILES notation for 4-ethenyl-2,3-diethylaniline?
The canonical SMILES for 4-ethenyl-2,3-diethylaniline is C=Cc1ccc(N)c(CC)c1CC.
What is the InChIKey of 4-ethenyl-2,3-diethylaniline?
The InChIKey is DNDLJWLYYHKICX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-4-9-7-8-12(13)11(6-3)10(9)5-2/h4,7-8H,1,5-6,13H2,2-3H3.
What are the key properties of 4-ethenyl-2,3-diethylaniline?
4-ethenyl-2,3-diethylaniline has a molecular weight of 175.27 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2,3-diethylaniline is sourced from PubChem (CID 70188085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).