About 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride
1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride (PubChem CID 173414257) has the molecular formula C13H18ClN
and a molecular weight of 223.75 g/mol. Its IUPAC name is 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride |
| PubChem CID | 173414257 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride |
| SMILES | C=Cc1cccc(CN(C)C)c1C=C.Cl |
| InChI | InChI=1S/C13H17N.ClH/c1-5-11-8-7-9-12(10-14(3)4)13(11)6-2;/h5-9H,1-2,10H2,3-4H3;1H |
| InChIKey | XSGNPHMQEYYNDK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride?
The IUPAC name of 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride (CID 173414257) is 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride.
What is the SMILES notation for 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride?
The canonical SMILES for 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride is C=Cc1cccc(CN(C)C)c1C=C.Cl.
What is the InChIKey of 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride?
The InChIKey is XSGNPHMQEYYNDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N.ClH/c1-5-11-8-7-9-12(10-14(3)4)13(11)6-2;/h5-9H,1-2,10H2,3-4H3;1H.
What are the key properties of 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride?
1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride has a molecular weight of 223.75 g/mol, XLogP of 3.46, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,3-bis(ethenyl)phenyl]-N,N-dimethylmethanamine;hydrochloride is sourced from PubChem (CID 173414257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).