C11H16O2 — CID 134586695
1,4-bis(ethenyl)-2-methylbenzene;dihydrate (PubChem CID 134586695) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1,4-bis(ethenyl)-2-methylbenzene;dihydrate.
| Compound Name | 1,4-bis(ethenyl)-2-methylbenzene;dihydrate |
|---|---|
| PubChem CID | 134586695 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1,4-bis(ethenyl)-2-methylbenzene;dihydrate |
| SMILES | C=Cc1ccc(C=C)c(C)c1.O.O |
| InChI | InChI=1S/C11H12.2H2O/c1-4-10-6-7-11(5-2)9(3)8-10;;/h4-8H,1-2H2,3H3;2*1H2 |
| InChIKey | QGDRVNODEGXFNX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |