C12H18 — CID 142852203
ethane;4-ethenyl-1,2-dimethylbenzene (PubChem CID 142852203) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is ethane;4-ethenyl-1,2-dimethylbenzene.
| Compound Name | ethane;4-ethenyl-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 142852203 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | ethane;4-ethenyl-1,2-dimethylbenzene |
| SMILES | C=Cc1ccc(C)c(C)c1.CC |
| InChI | InChI=1S/C10H12.C2H6/c1-4-10-6-5-8(2)9(3)7-10;1-2/h4-7H,1H2,2-3H3;1-2H3 |
| InChIKey | GAKZQVCDPWNGFR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |