About 4-ethenyl-2-methylphenol;styrene
4-ethenyl-2-methylphenol;styrene (PubChem CID 158833032) has the molecular formula C17H18O
and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-ethenyl-2-methylphenol;styrene.
Molecular Properties
| Compound Name | 4-ethenyl-2-methylphenol;styrene |
| PubChem CID | 158833032 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 4-ethenyl-2-methylphenol;styrene |
| SMILES | C=Cc1ccc(O)c(C)c1.C=Cc1ccccc1 |
| InChI | InChI=1S/C9H10O.C8H8/c1-3-8-4-5-9(10)7(2)6-8;1-2-8-6-4-3-5-7-8/h3-6,10H,1H2,2H3;2-7H,1H2 |
| InChIKey | IXHBLGPSEPFMLP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenyl-2-methylphenol;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2-methylphenol;styrene?
The IUPAC name of 4-ethenyl-2-methylphenol;styrene (CID 158833032) is 4-ethenyl-2-methylphenol;styrene.
What is the SMILES notation for 4-ethenyl-2-methylphenol;styrene?
The canonical SMILES for 4-ethenyl-2-methylphenol;styrene is C=Cc1ccc(O)c(C)c1.C=Cc1ccccc1.
What is the InChIKey of 4-ethenyl-2-methylphenol;styrene?
The InChIKey is IXHBLGPSEPFMLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C8H8/c1-3-8-4-5-9(10)7(2)6-8;1-2-8-6-4-3-5-7-8/h3-6,10H,1H2,2H3;2-7H,1H2.
What are the key properties of 4-ethenyl-2-methylphenol;styrene?
4-ethenyl-2-methylphenol;styrene has a molecular weight of 238.33 g/mol, XLogP of 4.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2-methylphenol;styrene is sourced from PubChem (CID 158833032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).