About CID 174884210
CID 174884210 (PubChem CID 174884210) has the molecular formula C11H15NSi
and a molecular weight of 189.33 g/mol.
Molecular Properties
| Compound Name | CID 174884210 |
| PubChem CID | 174884210 |
| Molecular Formula | C11H15NSi |
| Molecular Weight | 189.33 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | — |
| SMILES | C=Cc1ccc([Si]N(C)C)c(C)c1 |
| InChI | InChI=1S/C11H15NSi/c1-5-10-6-7-11(9(2)8-10)13-12(3)4/h5-8H,1H2,2-4H3 |
| InChIKey | QBKMISOAROQTOQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174884210 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174884210?
The IUPAC name of CID 174884210 (CID 174884210) is not available.
What is the SMILES notation for CID 174884210?
The canonical SMILES for CID 174884210 is C=Cc1ccc([Si]N(C)C)c(C)c1.
What is the InChIKey of CID 174884210?
The InChIKey is QBKMISOAROQTOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NSi/c1-5-10-6-7-11(9(2)8-10)13-12(3)4/h5-8H,1H2,2-4H3.
What are the key properties of CID 174884210?
CID 174884210 has a molecular weight of 189.33 g/mol, XLogP of 1.44, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174884210 is sourced from PubChem (CID 174884210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).