C15H26 — CID 145148540
ethane;2-ethenyl-1,3,4-trimethylbenzene (PubChem CID 145148540) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is ethane;2-ethenyl-1,3,4-trimethylbenzene.
| Compound Name | ethane;2-ethenyl-1,3,4-trimethylbenzene |
|---|---|
| PubChem CID | 145148540 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | ethane;2-ethenyl-1,3,4-trimethylbenzene |
| SMILES | C=Cc1c(C)ccc(C)c1C.CC.CC |
| InChI | InChI=1S/C11H14.2C2H6/c1-5-11-9(3)7-6-8(2)10(11)4;2*1-2/h5-7H,1H2,2-4H3;2*1-2H3 |
| InChIKey | MEQMLWPVLAKELV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |