C21H43N — CID 155736263
2,3-bis(ethenyl)-4-methylpyridine;ethane;propane (PubChem CID 155736263) has the molecular formula C21H43N and a molecular weight of 309.58 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4-methylpyridine;ethane;propane.
| Compound Name | 2,3-bis(ethenyl)-4-methylpyridine;ethane;propane |
|---|---|
| PubChem CID | 155736263 |
| Molecular Formula | C21H43N |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 309.34 |
| IUPAC Name | 2,3-bis(ethenyl)-4-methylpyridine;ethane;propane |
| SMILES | C=Cc1nccc(C)c1C=C.CC.CC.CC.CC.CCC |
| InChI | InChI=1S/C10H11N.C3H8.4C2H6/c1-4-9-8(3)6-7-11-10(9)5-2;1-3-2;4*1-2/h4-7H,1-2H2,3H3;3H2,1-2H3;4*1-2H3 |
| InChIKey | NMNUUXQJWAXXIJ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |