C14H20O — CID 145207353
[2,3-bis(ethenyl)-4-methylphenyl]methanol;ethane (PubChem CID 145207353) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is [2,3-bis(ethenyl)-4-methylphenyl]methanol;ethane.
| Compound Name | [2,3-bis(ethenyl)-4-methylphenyl]methanol;ethane |
|---|---|
| PubChem CID | 145207353 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | [2,3-bis(ethenyl)-4-methylphenyl]methanol;ethane |
| SMILES | C=Cc1c(C)ccc(CO)c1C=C.CC |
| InChI | InChI=1S/C12H14O.C2H6/c1-4-11-9(3)6-7-10(8-13)12(11)5-2;1-2/h4-7,13H,1-2,8H2,3H3;1-2H3 |
| InChIKey | AOQLVXHTOHEQKH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |