C9H11BrO — CID 66602570
(2-bromo-3,4-dimethylphenyl)methanol (PubChem CID 66602570) has the molecular formula C9H11BrO and a molecular weight of 215.09 g/mol. Its IUPAC name is (2-bromo-3,4-dimethylphenyl)methanol.
| Compound Name | (2-bromo-3,4-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 66602570 |
| Molecular Formula | C9H11BrO |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | (2-bromo-3,4-dimethylphenyl)methanol |
| SMILES | Cc1ccc(CO)c(Br)c1C |
| InChI | InChI=1S/C9H11BrO/c1-6-3-4-8(5-11)9(10)7(6)2/h3-4,11H,5H2,1-2H3 |
| InChIKey | IVNMRHCABPFWBC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |