C9H11NO3 — CID 130867143
(3,4-dimethyl-2-nitrophenyl)methanol (PubChem CID 130867143) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is (3,4-dimethyl-2-nitrophenyl)methanol.
| Compound Name | (3,4-dimethyl-2-nitrophenyl)methanol |
|---|---|
| PubChem CID | 130867143 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (3,4-dimethyl-2-nitrophenyl)methanol |
| SMILES | Cc1ccc(CO)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C9H11NO3/c1-6-3-4-8(5-11)9(7(6)2)10(12)13/h3-4,11H,5H2,1-2H3 |
| InChIKey | QLVRCWNPUKMCGA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|