C8H10N2O3 — CID 142530016
(4,6-dimethyl-5-nitro-3-pyridinyl)methanol (PubChem CID 142530016) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is (4,6-dimethyl-5-nitro-3-pyridinyl)methanol.
| Compound Name | (4,6-dimethyl-5-nitro-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 142530016 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | (4,6-dimethyl-5-nitro-3-pyridinyl)methanol |
| SMILES | Cc1ncc(CO)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O3/c1-5-7(4-11)3-9-6(2)8(5)10(12)13/h3,11H,4H2,1-2H3 |
| InChIKey | VPQDBMOQHRPXGS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|