C7H9BN2O4 — CID 140921399
(4,6-dimethyl-5-nitro-3-pyridinyl)boronic acid (PubChem CID 140921399) has the molecular formula C7H9BN2O4 and a molecular weight of 195.97 g/mol. Its IUPAC name is (4,6-dimethyl-5-nitro-3-pyridinyl)boronic acid.
| Compound Name | (4,6-dimethyl-5-nitro-3-pyridinyl)boronic acid |
|---|---|
| PubChem CID | 140921399 |
| Molecular Formula | C7H9BN2O4 |
| Molecular Weight | 195.97 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (4,6-dimethyl-5-nitro-3-pyridinyl)boronic acid |
| SMILES | Cc1ncc(B(O)O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H9BN2O4/c1-4-6(8(11)12)3-9-5(2)7(4)10(13)14/h3,11-12H,1-2H3 |
| InChIKey | WXYVTLPUVWCDOS-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.97 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|