C8H13N3O2 — CID 175754992
azane;2,3,5-trimethyl-4-nitropyridine (PubChem CID 175754992) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is azane;2,3,5-trimethyl-4-nitropyridine.
| Compound Name | azane;2,3,5-trimethyl-4-nitropyridine |
|---|---|
| PubChem CID | 175754992 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | azane;2,3,5-trimethyl-4-nitropyridine |
| SMILES | Cc1cnc(C)c(C)c1[N+](=O)[O-].N |
| InChI | InChI=1S/C8H10N2O2.H3N/c1-5-4-9-7(3)6(2)8(5)10(11)12;/h4H,1-3H3;1H3 |
| InChIKey | GXLYASYOSDJZOF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|