C8H12Cl2N2O3 — CID 141317816
2-(chloromethyl)-3,5-dimethyl-4-nitropyridine;hydrate;hydrochloride (PubChem CID 141317816) has the molecular formula C8H12Cl2N2O3 and a molecular weight of 255.10 g/mol. Its IUPAC name is 2-(chloromethyl)-3,5-dimethyl-4-nitropyridine;hydrate;hydrochloride.
| Compound Name | 2-(chloromethyl)-3,5-dimethyl-4-nitropyridine;hydrate;hydrochloride |
|---|---|
| PubChem CID | 141317816 |
| Molecular Formula | C8H12Cl2N2O3 |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 2-(chloromethyl)-3,5-dimethyl-4-nitropyridine;hydrate;hydrochloride |
| SMILES | Cc1cnc(CCl)c(C)c1[N+](=O)[O-].Cl.O |
| InChI | InChI=1S/C8H9ClN2O2.ClH.H2O/c1-5-4-10-7(3-9)6(2)8(5)11(12)13;;/h4H,3H2,1-2H3;1H;1H2 |
| InChIKey | AHHYEGASQLUBIT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|