C13H20N2O3 — CID 103182311
3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]pentan-2-ol (PubChem CID 103182311) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]pentan-2-ol.
| Compound Name | 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]pentan-2-ol |
|---|---|
| PubChem CID | 103182311 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]pentan-2-ol |
| SMILES | CCC(Cc1ncc(C)c([N+](=O)[O-])c1C)C(C)O |
| InChI | InChI=1S/C13H20N2O3/c1-5-11(10(4)16)6-12-9(3)13(15(17)18)8(2)7-14-12/h7,10-11,16H,5-6H2,1-4H3 |
| InChIKey | JRGWMUWAYLCHIE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|