C14H21BrN2O2 — CID 103182535
2-[2-(1-bromoethyl)-3-methylbutyl]-3,5-dimethyl-4-nitropyridine (PubChem CID 103182535) has the molecular formula C14H21BrN2O2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 2-[2-(1-bromoethyl)-3-methylbutyl]-3,5-dimethyl-4-nitropyridine.
| Compound Name | 2-[2-(1-bromoethyl)-3-methylbutyl]-3,5-dimethyl-4-nitropyridine |
|---|---|
| PubChem CID | 103182535 |
| Molecular Formula | C14H21BrN2O2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-[2-(1-bromoethyl)-3-methylbutyl]-3,5-dimethyl-4-nitropyridine |
| SMILES | Cc1cnc(CC(C(C)C)C(C)Br)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21BrN2O2/c1-8(2)12(11(5)15)6-13-10(4)14(17(18)19)9(3)7-16-13/h7-8,11-12H,6H2,1-5H3 |
| InChIKey | YTVBKJHEKSGAGQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|