C13H15N3O2 — CID 103184788
1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]cyclobutane-1-carbonitrile (PubChem CID 103184788) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]cyclobutane-1-carbonitrile.
| Compound Name | 1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 103184788 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]cyclobutane-1-carbonitrile |
| SMILES | Cc1cnc(CC2(C#N)CCC2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O2/c1-9-7-15-11(10(2)12(9)16(17)18)6-13(8-14)4-3-5-13/h7H,3-6H2,1-2H3 |
| InChIKey | SBKGVPVDLIDPIF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|