C8H10N2O3 — CID 118881791
2-methoxy-4,5-dimethyl-3-nitropyridine (PubChem CID 118881791) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethyl-3-nitropyridine.
| Compound Name | 2-methoxy-4,5-dimethyl-3-nitropyridine |
|---|---|
| PubChem CID | 118881791 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-methoxy-4,5-dimethyl-3-nitropyridine |
| SMILES | COc1ncc(C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O3/c1-5-4-9-8(13-3)7(6(5)2)10(11)12/h4H,1-3H3 |
| InChIKey | URPPHZLMCGJUAE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|