C7H7N5O2 — CID 58758112
2-azido-3,5-dimethyl-4-nitropyridine (PubChem CID 58758112) has the molecular formula C7H7N5O2 and a molecular weight of 193.17 g/mol. Its IUPAC name is 2-azido-3,5-dimethyl-4-nitropyridine.
| Compound Name | 2-azido-3,5-dimethyl-4-nitropyridine |
|---|---|
| PubChem CID | 58758112 |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-azido-3,5-dimethyl-4-nitropyridine |
| SMILES | Cc1cnc(N=[N+]=[N-])c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N5O2/c1-4-3-9-7(10-11-8)5(2)6(4)12(13)14/h3H,1-2H3 |
| InChIKey | ZCXPMYGQNNVOAF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 104.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|