C5H6N6O2 — CID 80583648
5-azido-1,3-dimethyl-4-nitropyrazole (PubChem CID 80583648) has the molecular formula C5H6N6O2 and a molecular weight of 182.14 g/mol. Its IUPAC name is 5-azido-1,3-dimethyl-4-nitropyrazole.
| Compound Name | 5-azido-1,3-dimethyl-4-nitropyrazole |
|---|---|
| PubChem CID | 80583648 |
| Molecular Formula | C5H6N6O2 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 5-azido-1,3-dimethyl-4-nitropyrazole |
| SMILES | Cc1nn(C)c(N=[N+]=[N-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C5H6N6O2/c1-3-4(11(12)13)5(7-9-6)10(2)8-3/h1-2H3 |
| InChIKey | BWIHUVSJIJCMFN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|