C6H9N5O3 — CID 154085797
N'-hydroxy-1,3-dimethyl-4-nitropyrazole-5-carboximidamide (PubChem CID 154085797) has the molecular formula C6H9N5O3 and a molecular weight of 199.17 g/mol. Its IUPAC name is N'-hydroxy-1,3-dimethyl-4-nitropyrazole-5-carboximidamide.
| Compound Name | N'-hydroxy-1,3-dimethyl-4-nitropyrazole-5-carboximidamide |
|---|---|
| PubChem CID | 154085797 |
| Molecular Formula | C6H9N5O3 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | N'-hydroxy-1,3-dimethyl-4-nitropyrazole-5-carboximidamide |
| SMILES | Cc1nn(C)c(C(N)=NO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H9N5O3/c1-3-4(11(13)14)5(6(7)9-12)10(2)8-3/h12H,1-2H3,(H2,7,9) |
| InChIKey | JTGIORWWNSIOBN-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|