C5H9N5O2 — CID 3537257
(1,3-dimethyl-4-nitropyrazol-5-yl)hydrazine (PubChem CID 3537257) has the molecular formula C5H9N5O2 and a molecular weight of 171.16 g/mol. Its IUPAC name is (1,3-dimethyl-4-nitropyrazol-5-yl)hydrazine.
| Compound Name | (1,3-dimethyl-4-nitropyrazol-5-yl)hydrazine |
|---|---|
| PubChem CID | 3537257 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | (1,3-dimethyl-4-nitropyrazol-5-yl)hydrazine |
| SMILES | Cc1nn(C)c(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C5H9N5O2/c1-3-4(10(11)12)5(7-6)9(2)8-3/h7H,6H2,1-2H3 |
| InChIKey | CAORIXXJMUEMIO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|