C9H12N4O2 — CID 114382971
N-but-3-yn-2-yl-1,3-dimethyl-4-nitropyrazol-5-amine (PubChem CID 114382971) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is N-but-3-yn-2-yl-1,3-dimethyl-4-nitropyrazol-5-amine.
| Compound Name | N-but-3-yn-2-yl-1,3-dimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 114382971 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-but-3-yn-2-yl-1,3-dimethyl-4-nitropyrazol-5-amine |
| SMILES | C#CC(C)Nc1c([N+](=O)[O-])c(C)nn1C |
| InChI | InChI=1S/C9H12N4O2/c1-5-6(2)10-9-8(13(14)15)7(3)11-12(9)4/h1,6,10H,2-4H3 |
| InChIKey | IFUUHSAISJTNEP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|