C12H22N4O2 — CID 54950632
N-heptan-2-yl-1,3-dimethyl-4-nitropyrazol-5-amine (PubChem CID 54950632) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is N-heptan-2-yl-1,3-dimethyl-4-nitropyrazol-5-amine.
| Compound Name | N-heptan-2-yl-1,3-dimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 54950632 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | N-heptan-2-yl-1,3-dimethyl-4-nitropyrazol-5-amine |
| SMILES | CCCCCC(C)Nc1c([N+](=O)[O-])c(C)nn1C |
| InChI | InChI=1S/C12H22N4O2/c1-5-6-7-8-9(2)13-12-11(16(17)18)10(3)14-15(12)4/h9,13H,5-8H2,1-4H3 |
| InChIKey | IPSDMNCSTNEBBB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|