C14H26N4S — CID 63756698
1,3-dimethyl-5-(octan-2-ylamino)pyrazole-4-carbothioamide (PubChem CID 63756698) has the molecular formula C14H26N4S and a molecular weight of 282.46 g/mol. Its IUPAC name is 1,3-dimethyl-5-(octan-2-ylamino)pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-(octan-2-ylamino)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63756698 |
| Molecular Formula | C14H26N4S |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1,3-dimethyl-5-(octan-2-ylamino)pyrazole-4-carbothioamide |
| SMILES | CCCCCCC(C)Nc1c(C(N)=S)c(C)nn1C |
| InChI | InChI=1S/C14H26N4S/c1-5-6-7-8-9-10(2)16-14-12(13(15)19)11(3)17-18(14)4/h10,16H,5-9H2,1-4H3,(H2,15,19) |
| InChIKey | NBEOOGONUQXDEM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|