C16H28N4S — CID 80511129
5,6-diethyl-3-(heptan-2-ylamino)pyridazine-4-carbothioamide (PubChem CID 80511129) has the molecular formula C16H28N4S and a molecular weight of 308.50 g/mol. Its IUPAC name is 5,6-diethyl-3-(heptan-2-ylamino)pyridazine-4-carbothioamide.
| Compound Name | 5,6-diethyl-3-(heptan-2-ylamino)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80511129 |
| Molecular Formula | C16H28N4S |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 5,6-diethyl-3-(heptan-2-ylamino)pyridazine-4-carbothioamide |
| SMILES | CCCCCC(C)Nc1nnc(CC)c(CC)c1C(N)=S |
| InChI | InChI=1S/C16H28N4S/c1-5-8-9-10-11(4)18-16-14(15(17)21)12(6-2)13(7-3)19-20-16/h11H,5-10H2,1-4H3,(H2,17,21)(H,18,20) |
| InChIKey | XLVVBJQSESOLIE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|