C14H17N5S — CID 80510897
5,6-diethyl-3-(pyridin-3-ylamino)pyridazine-4-carbothioamide (PubChem CID 80510897) has the molecular formula C14H17N5S and a molecular weight of 287.39 g/mol. Its IUPAC name is 5,6-diethyl-3-(pyridin-3-ylamino)pyridazine-4-carbothioamide.
| Compound Name | 5,6-diethyl-3-(pyridin-3-ylamino)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80510897 |
| Molecular Formula | C14H17N5S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5,6-diethyl-3-(pyridin-3-ylamino)pyridazine-4-carbothioamide |
| SMILES | CCc1nnc(Nc2cccnc2)c(C(N)=S)c1CC |
| InChI | InChI=1S/C14H17N5S/c1-3-10-11(4-2)18-19-14(12(10)13(15)20)17-9-6-5-7-16-8-9/h5-8H,3-4H2,1-2H3,(H2,15,20)(H,17,19) |
| InChIKey | WFNSEUAZNFDSBJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|