C13H17N5S2 — CID 80510884
5,6-diethyl-3-[(5-methyl-1,3-thiazol-2-yl)amino]pyridazine-4-carbothioamide (PubChem CID 80510884) has the molecular formula C13H17N5S2 and a molecular weight of 307.45 g/mol. Its IUPAC name is 5,6-diethyl-3-[(5-methyl-1,3-thiazol-2-yl)amino]pyridazine-4-carbothioamide.
| Compound Name | 5,6-diethyl-3-[(5-methyl-1,3-thiazol-2-yl)amino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80510884 |
| Molecular Formula | C13H17N5S2 |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 5,6-diethyl-3-[(5-methyl-1,3-thiazol-2-yl)amino]pyridazine-4-carbothioamide |
| SMILES | CCc1nnc(Nc2ncc(C)s2)c(C(N)=S)c1CC |
| InChI | InChI=1S/C13H17N5S2/c1-4-8-9(5-2)17-18-12(10(8)11(14)19)16-13-15-6-7(3)20-13/h6H,4-5H2,1-3H3,(H2,14,19)(H,15,16,18) |
| InChIKey | WZLRCVGFJXVIDE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|