C12H13N3OS2 — CID 81306393
4-methoxy-2-[(5-methyl-1,3-thiazol-2-yl)amino]benzenecarbothioamide (PubChem CID 81306393) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-methoxy-2-[(5-methyl-1,3-thiazol-2-yl)amino]benzenecarbothioamide.
| Compound Name | 4-methoxy-2-[(5-methyl-1,3-thiazol-2-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 81306393 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 4-methoxy-2-[(5-methyl-1,3-thiazol-2-yl)amino]benzenecarbothioamide |
| SMILES | COc1ccc(C(N)=S)c(Nc2ncc(C)s2)c1 |
| InChI | InChI=1S/C12H13N3OS2/c1-7-6-14-12(18-7)15-10-5-8(16-2)3-4-9(10)11(13)17/h3-6H,1-2H3,(H2,13,17)(H,14,15) |
| InChIKey | BMTTWYXLMBIRDJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|