C10H15N3OS — CID 83016164
2-(2,2-dimethylhydrazinyl)-4-methoxybenzenecarbothioamide (PubChem CID 83016164) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 2-(2,2-dimethylhydrazinyl)-4-methoxybenzenecarbothioamide.
| Compound Name | 2-(2,2-dimethylhydrazinyl)-4-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 83016164 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-(2,2-dimethylhydrazinyl)-4-methoxybenzenecarbothioamide |
| SMILES | COc1ccc(C(N)=S)c(NN(C)C)c1 |
| InChI | InChI=1S/C10H15N3OS/c1-13(2)12-9-6-7(14-3)4-5-8(9)10(11)15/h4-6,12H,1-3H3,(H2,11,15) |
| InChIKey | LPHWCFYTPGURDC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|