C9H12ClN3S — CID 83016390
4-chloro-2-(2,2-dimethylhydrazinyl)benzenecarbothioamide (PubChem CID 83016390) has the molecular formula C9H12ClN3S and a molecular weight of 229.74 g/mol. Its IUPAC name is 4-chloro-2-(2,2-dimethylhydrazinyl)benzenecarbothioamide.
| Compound Name | 4-chloro-2-(2,2-dimethylhydrazinyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 83016390 |
| Molecular Formula | C9H12ClN3S |
| Molecular Weight | 229.74 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 4-chloro-2-(2,2-dimethylhydrazinyl)benzenecarbothioamide |
| SMILES | CN(C)Nc1cc(Cl)ccc1C(N)=S |
| InChI | InChI=1S/C9H12ClN3S/c1-13(2)12-8-5-6(10)3-4-7(8)9(11)14/h3-5,12H,1-2H3,(H2,11,14) |
| InChIKey | GXZRMUIWXBNUAZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.74 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|