C14H23N3O2S — CID 81305583
4-methoxy-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]benzenecarbothioamide (PubChem CID 81305583) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 4-methoxy-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]benzenecarbothioamide.
| Compound Name | 4-methoxy-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 81305583 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-methoxy-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]benzenecarbothioamide |
| SMILES | COCCN(C)CCNc1cc(OC)ccc1C(N)=S |
| InChI | InChI=1S/C14H23N3O2S/c1-17(8-9-18-2)7-6-16-13-10-11(19-3)4-5-12(13)14(15)20/h4-5,10,16H,6-9H2,1-3H3,(H2,15,20) |
| InChIKey | NISHIXYAOAECJB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|