C11H17N3O3S2 — CID 81306767
4-methoxy-2-(3-sulfamoylpropylamino)benzenecarbothioamide (PubChem CID 81306767) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-methoxy-2-(3-sulfamoylpropylamino)benzenecarbothioamide.
| Compound Name | 4-methoxy-2-(3-sulfamoylpropylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 81306767 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-methoxy-2-(3-sulfamoylpropylamino)benzenecarbothioamide |
| SMILES | COc1ccc(C(N)=S)c(NCCCS(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H17N3O3S2/c1-17-8-3-4-9(11(12)18)10(7-8)14-5-2-6-19(13,15)16/h3-4,7,14H,2,5-6H2,1H3,(H2,12,18)(H2,13,15,16) |
| InChIKey | ZORHNQFQNSFJIW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|