C16H20N2OS2 — CID 81297363
4-methoxy-2-[1-(5-methylthiophen-2-yl)propan-2-ylamino]benzenecarbothioamide (PubChem CID 81297363) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 4-methoxy-2-[1-(5-methylthiophen-2-yl)propan-2-ylamino]benzenecarbothioamide.
| Compound Name | 4-methoxy-2-[1-(5-methylthiophen-2-yl)propan-2-ylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 81297363 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 4-methoxy-2-[1-(5-methylthiophen-2-yl)propan-2-ylamino]benzenecarbothioamide |
| SMILES | COc1ccc(C(N)=S)c(NC(C)Cc2ccc(C)s2)c1 |
| InChI | InChI=1S/C16H20N2OS2/c1-10(8-13-6-4-11(2)21-13)18-15-9-12(19-3)5-7-14(15)16(17)20/h4-7,9-10,18H,8H2,1-3H3,(H2,17,20) |
| InChIKey | RQHYFEWDJCQUHT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|