C14H17BrN4S2 — CID 80511741
3-[(4-bromothiophen-2-yl)methylamino]-5,6-diethylpyridazine-4-carbothioamide (PubChem CID 80511741) has the molecular formula C14H17BrN4S2 and a molecular weight of 385.36 g/mol. Its IUPAC name is 3-[(4-bromothiophen-2-yl)methylamino]-5,6-diethylpyridazine-4-carbothioamide.
| Compound Name | 3-[(4-bromothiophen-2-yl)methylamino]-5,6-diethylpyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80511741 |
| Molecular Formula | C14H17BrN4S2 |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 3-[(4-bromothiophen-2-yl)methylamino]-5,6-diethylpyridazine-4-carbothioamide |
| SMILES | CCc1nnc(NCc2cc(Br)cs2)c(C(N)=S)c1CC |
| InChI | InChI=1S/C14H17BrN4S2/c1-3-10-11(4-2)18-19-14(12(10)13(16)20)17-6-9-5-8(15)7-21-9/h5,7H,3-4,6H2,1-2H3,(H2,16,20)(H,17,19) |
| InChIKey | SJYNYFVLHWFKEU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|